CAS 6009-12-7
:4-{[2-hydroxy-4-methoxy-6-(2-oxoheptyl)benzoyl]oxy}-2-methoxy-6-pentylbenzoic acid
Description:
The chemical substance known as "4-{[2-hydroxy-4-methoxy-6-(2-oxoheptyl)benzoyl]oxy}-2-methoxy-6-pentylbenzoic acid," with the CAS number 6009-12-7, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid core, which is substituted with various functional groups, including methoxy and hydroxy groups, contributing to its potential solubility and reactivity. The presence of a heptyl chain and a ketone group indicates that it may exhibit hydrophobic properties, influencing its behavior in biological systems and its interaction with other molecules. This compound may be of interest in fields such as pharmaceuticals, where its structural characteristics could be leveraged for specific biological activities or as a potential drug candidate. Additionally, the presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could play a role in its stability and interactions with other compounds. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research and application.
Formula:C28H36O8
InChI:InChI=1/C28H36O8/c1-5-7-9-11-18-14-22(17-24(35-4)26(18)27(31)32)36-28(33)25-19(13-20(29)12-10-8-6-2)15-21(34-3)16-23(25)30/h14-17,30H,5-13H2,1-4H3,(H,31,32)
SMILES:CCCCCc1cc(cc(c1C(=O)O)OC)OC(=O)c1c(CC(=O)CCCCC)cc(cc1O)OC
Synonyms:- Benzoic Acid, 2-Hydroxy-4-Methoxy-6-(2-Oxoheptyl)-, 4-Carboxy-3-Methoxy-5-Pentylphenyl Ester
- Confluentic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Confluentic acid
CAS:Confluentic acid shows selective inhibition of Monoamine oxidase B with IC50 value of 0.22 microM.Formula:C28H36O8Purity:98%Color and Shape:SolidMolecular weight:500.58Confluentic acid
CAS:Please enquire for more information about Confluentic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C28H36O8Purity:Min. 95%Molecular weight:500.6 g/mol


