CAS 60090-47-3: N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide
Description:N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide, with the CAS number 60090-47-3, is a chemical compound that belongs to the class of amides. This substance features a hydroxyacetamide functional group, which contributes to its potential applications in pharmaceuticals and agrochemicals. The presence of an ethoxymethyl group enhances its solubility and reactivity, while the 2-ethyl-6-methylphenyl moiety may influence its biological activity and interaction with various targets. The compound is likely to exhibit moderate polarity due to the combination of hydrophilic (hydroxy and amide) and hydrophobic (ethyl and methyl groups) characteristics. Its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties such as melting point and boiling point. Additionally, the compound may possess specific biological activities, making it of interest in medicinal chemistry. However, detailed studies on its toxicity, stability, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C14H21NO3
InChI:InChI=1/C14H21NO3/c1-4-12-8-6-7-11(3)14(12)15(10-18-5-2)13(17)9-16/h6-8,16H,4-5,9-10H2,1-3H3
- Synonyms:
- acetamide, N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-hydroxy-
- N-(Ethoxymethyl)-N-(2-ethyl-6-methylphenyl)-2-hydroxyacetamide
- Acetochlor-2-hydroxy, 100 μg /μL in Acetonitrile
- Acetochlor-2-hydroxy Solution
- 2-hydroxy-N-(ethoxymethyl)-N-(2-ethyl-6-methylphenyl)acetamide
- Acetochlor-2-hydroxy
- N-(ethoxymethyl)-N-(2-ethyl-6-methyl-phenyl)-2-hydroxy-acetamide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Acetochlor-2-hydroxy 100 µg/mL in Acetonitrile REF: 04-XA10018250ALCAS: 60090-47-3 | - - - | 233.00 € | Mon 18 Aug 25 |

Acetochlor-2-hydroxy 100 µg/mL in Acetonitrile
Ref: 04-XA10018250AL
1ml | 233.00 € |