CAS 60091-87-4

2-[(4-chloro-2-nitrophenyl)amino]benzoic acid

Description:

2-[(4-chloro-2-nitrophenyl)amino]benzoic acid, with the CAS number 60091-87-4, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety and an amino group attached to a chloronitrophenyl group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and as a chemical intermediate. The presence of the chloro and nitro substituents on the phenyl ring contributes to its reactivity and may influence its biological activity. The carboxylic acid functional group provides acidic properties, allowing for potential interactions in various chemical environments. Additionally, the compound's solubility can vary depending on the solvent used, and it may exhibit specific UV-Vis absorption characteristics due to its conjugated system. Safety data should be consulted, as compounds with halogen and nitro groups can pose health risks and environmental concerns. Overall, 2-[(4-chloro-2-nitrophenyl)amino]benzoic acid is a notable compound in organic chemistry with diverse implications in research and industry.

Formula: C₁₃H₉ClN₂O₄

InChI: InChI=1/C13H9ClN2O4/c14-8-5-6-11(12(7-8)16(19)20)15-10-4-2-1-3-9(10)13(17)18/h1-7,15H,(H,17,18)

SMILES: c1ccc(c(c1)C(=O)O)Nc1ccc(cc1N(=O)=O)Cl

Synonyms:

• Benzoic Acid, 2-[(4-Chloro-2-Nitrophenyl)Amino]-
• 2-[(4-Chloro-2-nitrophenyl)amino]-benzoic acid

2-[(4-CHLORO-2-NITROPHENYL)AMINO]-BENZOIC ACID

CAS: 60091-87-4

Formula: C₁₃H₉ClN₂O₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 292.6746

Ref: IN-DA00E8S6

2-((4-Chloro-2-nitrophenyl)amino)benzoic acid

CAS: 60091-87-4

2-((4-Chloro-2-nitrophenyl)amino)benzoic acid

Purity: 95%

Molecular weight: 292.68g/mol

Ref: 54-OR1072306

Clozapine Impurity 7

CAS: 60091-87-4

Formula: C₁₃H₉ClN₂O₄

Color and Shape: Brown Solid

Molecular weight: 292.68

Ref: 4Z-C-1422

Clozapine Impurity 5

CAS: 60091-87-4

Formula: C₁₃H₉ClN₂O₄

Molecular weight: 292.7

Ref: ST-EA-CP-C63017

2-((4-Chloro-2-nitrophenyl)amino)benzoic acid

CAS: 60091-87-4

Formula: C₁₃H₉ClN₂O₄

Purity: 95%

Molecular weight: 292.68

Ref: 10-F320182

2-[(4-Chloro-2-nitrophenyl)amino]benzoic Acid

Controlled Product

CAS: 60091-87-4

Applications 2-[(4-Chloro-2-nitrophenyl)amino]benzoic Acid is an diazepinomicin derivative with potential antcancer activity. 2-[(4-Chloro-2-nitrophenyl)amino]benzoic Acid is also an impurity in the synthesis of Clozepine (C587500), an antipsychotic.
References Yu, Y.G., et al.: Lett. Drug. Design. Discov., 10, 369 (3013);

Formula: C₁₃H₉ClN₂O₄

Color and Shape: Neat

Molecular weight: 292.67

Ref: TR-C373950