CymitQuimica logo

CAS 60104-30-5

:

Orazamide

Description:
Orazamide, with the CAS number 60104-30-5, is a chemical compound that belongs to the class of amides. It is characterized by its structural features, which include a carbonyl group (C=O) directly attached to a nitrogen atom (N), typical of amides. Orazamide is known for its potential applications in various fields, including pharmaceuticals and agriculture, due to its biological activity. The compound may exhibit properties such as solubility in polar solvents, stability under certain conditions, and the ability to form hydrogen bonds, which can influence its reactivity and interactions with other substances. Additionally, like many amides, Orazamide may participate in various chemical reactions, including hydrolysis and amidation. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on its molecular structure and the presence of functional groups. As with any chemical substance, safety data and handling precautions should be considered when working with Orazamide.
Formula:C9H10N6O5
InChI:InChI=1/C5H4N2O4.C4H6N4O/c8-3-1-2(4(9)10)6-5(11)7-3;5-3-2(4(6)9)7-1-8-3/h1H,(H,9,10)(H2,6,7,8,11);1H,5H2,(H2,6,9)(H,7,8)
SMILES:c1c(C(=O)O)nc(nc1O)O.c1nc(c(N)[nH]1)C(=N)O
Synonyms:
  • 4-Amino-5-imidazolecarboxamide orotate
  • 5-Aminoimidazole-4-carboxamide orotate
  • 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid - 4-amino-1H-imidazole-5-carboxamide (1:1)
  • 1,2,3,6-tetrahydro-2,6-dioxopyrimidine-4-carboxylic acid, compound with 5-amino-1H-imidazole-4-carboxamide (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.