CAS 60113-74-8
:1-(Difluoromethoxy)-1,2,2-trifluoroethane
Description:
1-(Difluoromethoxy)-1,2,2-trifluoroethane, with the CAS number 60113-74-8, is a fluorinated organic compound characterized by its unique structure, which includes a trifluoroethane backbone and a difluoromethoxy functional group. This compound is typically colorless and may exhibit a low boiling point, making it volatile. It is known for its stability under standard conditions, but it can undergo reactions typical of ethers and fluorinated compounds, such as nucleophilic substitution. The presence of multiple fluorine atoms contributes to its hydrophobic nature and can enhance its chemical resistance. This substance is often utilized in various applications, including as a solvent or in the synthesis of other fluorinated compounds. Due to its fluorinated nature, it may have implications for environmental and health safety, necessitating careful handling and consideration of its potential effects. Overall, 1-(Difluoromethoxy)-1,2,2-trifluoroethane is a notable compound in the field of fluorinated chemicals, with specific properties that make it valuable in industrial and research contexts.
Formula:C3H3F5O
InChI:InChI=1S/C3H3F5O/c4-1(5)2(6)9-3(7)8/h1-3H
InChI key:InChIKey=KQUULKREOKHZAM-UHFFFAOYSA-N
SMILES:C(OC(F)F)(C(F)F)F
Synonyms:- HFC 245caEαβ
- 1-(Difluoromethoxy)-1,2,2-trifluoroethane
- Ethane, 1-(difluoromethoxy)-1,2,2-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

