CAS 60116-43-0

2-[(2-methylbenzyl)sulfanyl]ethanamine

Description:

2-[(2-methylbenzyl)sulfanyl]ethanamine, with the CAS number 60116-43-0, is an organic compound characterized by the presence of both an amine and a thioether functional group. This compound features a two-carbon ethyl chain attached to an amine group, with a sulfanyl (thioether) substituent linked to a 2-methylbenzyl group. The presence of the sulfur atom contributes to its unique chemical properties, including potential reactivity in nucleophilic substitution reactions. The aromatic ring from the 2-methylbenzyl moiety can influence the compound's solubility and stability, as well as its interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural characteristics suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many amines, it may also exhibit basicity, allowing it to participate in acid-base reactions. Safety and handling precautions should be observed due to the potential toxicity associated with amines and sulfur-containing compounds.

Formula: C₁₀H₁₅NS

InChI: InChI=1/C10H15NS/c1-9-4-2-3-5-10(9)8-12-7-6-11/h2-5H,6-8,11H2,1H3

SMILES: Cc1ccccc1CSCCN

Synonyms:

• Ethanamine, 2-[[(2-Methylphenyl)Methyl]Thio]-

2-((2-Methylbenzyl)thio)ethan-1-amine

CAS: 60116-43-0

2-((2-Methylbenzyl)thio)ethan-1-amine

Purity: 98%

Molecular weight: 181.3g/mol

Ref: 54-OR1032419

2-[(2-methylbenzyl)thio]ethanamine

CAS: 60116-43-0

Formula: C₁₀H₁₅NS

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.3

Ref: 10-F311708