CAS 60117-17-1

L-tyrosylglycylglycyl-L-phenylalanyl-L-methioninamide

Description:

L-tyrosylglycylglycyl-L-phenylalanyl-L-methioninamide, with the CAS number 60117-17-1, is a synthetic peptide that consists of a sequence of amino acids, specifically tyrosine, glycine, phenylalanine, and methionine. This compound is characterized by its structural complexity, which allows it to participate in various biochemical interactions. Peptides like this one often exhibit properties such as solubility in water, depending on the specific amino acid composition and sequence. They can also demonstrate biological activity, potentially influencing processes such as cell signaling or acting as precursors to larger proteins. The presence of aromatic amino acids, such as tyrosine and phenylalanine, may contribute to its ability to absorb ultraviolet light, which is a common characteristic of many peptides. Additionally, the amide bond formation in the structure suggests stability under physiological conditions, making it of interest in pharmaceutical and biochemical research. Overall, this compound's unique sequence and properties make it a subject of interest in studies related to peptide synthesis and function.

Formula: C₂₇H₃₆N₆O₆S

InChI: InChI=1/C27H36N6O6S/c1-40-12-11-21(25(29)37)33-27(39)22(14-17-5-3-2-4-6-17)32-24(36)16-30-23(35)15-31-26(38)20(28)13-18-7-9-19(34)10-8-18/h2-10,20-22,34H,11-16,28H2,1H3,(H2,29,37)(H,30,35)(H,31,38)(H,32,36)(H,33,39)/t20-,21-,22-/m0/s1

SMILES: CSCC[C@@H](C(=N)O)N=C([C@H](Cc1ccccc1)N=C(CN=C(CN=C([C@H](Cc1ccc(cc1)O)N)O)O)O)O

Synonyms:

• L-methioninamide, L-tyrosylglycylglycyl-L-phenylalanyl-
• 5-Methionine-enkephalin amide

[Met5]-Enkephalin Amide

CAS: 60117-17-1

Formula: C₂₇H₃₆N₆O₆S

Purity: 98%

Molecular weight: 572.6763

Ref: IN-DA00EM05

[Met5]-Enkephalin, amide

CAS: 60117-17-1

[Met5]-Enkephalin, amide activates δ and ζ opioid receptors; has multiple forms and varying plasma levels.

Formula: C₂₇H₃₆N₆O₆S

Purity: 98%

Color and Shape: Solid

Molecular weight: 572.68

Ref: TM-TP1255