
CAS 60142-89-4
:7-(boc-amino)heptanoic acid
Description:
7-(Boc-amino)heptanoic acid is an amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino functional group and a heptanoic acid backbone. This compound features a seven-carbon aliphatic chain, which contributes to its hydrophobic characteristics, while the carboxylic acid group provides acidity and potential for forming salts. The Boc group serves as a protective moiety, commonly used in peptide synthesis to prevent unwanted reactions at the amino group during chemical transformations. The presence of both the amino and carboxylic acid functional groups allows for the formation of peptides and other derivatives through standard coupling reactions. This compound is typically utilized in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. Its solubility is influenced by the length of the carbon chain and the functional groups present, making it relevant in various chemical and biochemical applications. Safety and handling precautions should be observed, as with all chemical substances, to ensure proper laboratory practices.
Formula:C12H23NO4
InChI:InChI=1/C12H23NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8-10(14)15/h4-9H2,1-3H3,(H,13,16)(H,14,15)
SMILES:CC(C)(C)OC(=NCCCCCCC(=O)O)O
Synonyms:- Boc-7-amino-heptanoic acid
- Boc-7-Ahp-OH
- 7-[(Tert-Butoxycarbonyl)Amino]Heptanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
7-((tert-Butoxycarbonyl)amino)heptanoic acid
CAS:Formula:C12H23NO4Purity:95%Color and Shape:SolidMolecular weight:245.31537-((tert-Butoxycarbonyl)amino)heptanoic acid
CAS:7-((tert-Butoxycarbonyl)amino)heptanoic acidPurity:97%Molecular weight:245.319g/mol7-Aminoheptanoic acid, N-BOC protected
CAS:7-Aminoheptanoic acid, N-BOC protectedPurity:97%Molecular weight:245.31531g/molN-(tert-Butoxycarbonyl)-7-aminoheptanoic Acid
CAS:Formula:C12H23NO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:245.327-((tert-Butoxycarbonyl)amino)heptanoic acid
CAS:Formula:C12H23NO4Purity:95%Color and Shape:Solid, Beige powderMolecular weight:245.319Boc-7-Aminoheptanoic acid
CAS:Boc-7-Aminoheptanoic acid is a PROTAC linker with a Boc-protected amine and terminal carboxylic acid for stable amide formation.Formula:C12H23NO4Color and Shape:SolidMolecular weight:245.32





