CAS 60148-13-2
:2-(isocyanomethyl)pyridine
Description:
2-(Isocyanomethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the isocyanomethyl group (-CH2-N=C=O) at the 2-position of the pyridine ring introduces unique reactivity, particularly in nucleophilic addition and cycloaddition reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the isocyanate functional group, which can participate in various chemical transformations. Additionally, 2-(isocyanomethyl)pyridine may exhibit moderate toxicity and should be handled with care, following appropriate safety protocols. Its solubility in organic solvents and reactivity with nucleophiles make it a valuable intermediate in synthetic chemistry. As with many isocyanates, it may also pose health risks, necessitating proper protective measures during handling and use.
Formula:C7H6N2
InChI:InChI=1/C7H6N2/c1-8-6-7-4-2-3-5-9-7/h2-5H,6H2
SMILES:[C-]#[N+]Cc1ccccn1
Synonyms:- Pyridine, 2-(Isocyanomethyl)-
- 2-Isocyanomethylpridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.