CAS 601514-19-6

3-{[6-(3-aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy}phenol

Description:

3-{[6-(3-aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy}phenol, with the CAS number 601514-19-6, is a chemical compound characterized by its complex structure, which includes a pyrrolo[2,3-d]pyrimidine core linked to a phenolic moiety. This compound features an amino group attached to a phenyl ring, contributing to its potential biological activity. The presence of the pyrrolo[2,3-d]pyrimidine framework suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The ether linkage between the pyrimidine and phenol groups enhances its solubility and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's structural features may influence its interaction with biological targets, potentially leading to applications in cancer research or other therapeutic areas. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development due to their diverse biological activities.

Formula: C₁₈H₁₄N₄O₂

InChI: InChI=1/C18H14N4O2/c19-12-4-1-3-11(7-12)16-9-15-17(22-16)20-10-21-18(15)24-14-6-2-5-13(23)8-14/h1-10,23H,19H2,(H,20,21,22)

SMILES: c1cc(cc(c1)N)c1cc2c(nc[nH]c2Oc2cccc(c2)O)n1

Synonyms:

• Nsc 405020

3-[[6-(3-Aminophenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenol

CAS: 601514-19-6

Formula: C₁₈H₁₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 318.3294

Ref: IN-DA0037GX

TWS119

CAS: 601514-19-6

TWS119

Purity: ≥98%

Molecular weight: 318.33g/mol

Ref: 54-BUP06521

TWS 119

CAS: 601514-19-6

Formula: C₁₈H₁₄N₄O₂

Purity: >95.0%(HPLC)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 318.34

Ref: 3B-T3605

TWS119

CAS: 601514-19-6

TWS119 is a GSK-3β inhibitor; capable of inducing neuronal differentiation

Formula: C₁₈H₁₄N₄O₂

Purity: 98.14% - 99.63%

Color and Shape: Solid

Molecular weight: 318.33

Ref: TM-T2166