CAS 601515-40-6
:5,6,7,8-tetrahydro-2,6-naphthyridin-1-amine
Description:
5,6,7,8-Tetrahydro-2,6-naphthyridin-1-amine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a saturated ring system, contributing to its stability and potential biological activity. The presence of an amine functional group indicates that it can participate in hydrogen bonding and may exhibit basic properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with naphthyridine derivatives are often explored for their biological activities, including antimicrobial and anticancer properties. The compound's solubility, reactivity, and interaction with biological targets can vary based on its specific substituents and the environment. Additionally, the CAS number 601515-40-6 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, 5,6,7,8-tetrahydro-2,6-naphthyridin-1-amine represents a class of compounds with significant interest in both synthetic and medicinal chemistry.
Formula:C8H11N3
InChI:InChI=1/C8H11N3/c9-8-7-2-3-10-5-6(7)1-4-11-8/h1,4,10H,2-3,5H2,(H2,9,11)
SMILES:c1c[nH]c(=N)c2CCNCc12
Synonyms:- 2,6-Naphthyridin-1-Amine, 5,6,7,8-Tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5,6,7,8-Tetrahydro-2,6-naphthyridin-1-amine
CAS:Controlled ProductFormula:C8H11N3Color and Shape:NeatMolecular weight:149.193

