CymitQuimica logo

CAS 60166-43-0

:

1,4-diMethyl-1H-1,2,3-triazole

Description:
1,4-Dimethyl-1H-1,2,3-triazole is a heterocyclic organic compound characterized by a five-membered ring containing three nitrogen atoms and two carbon atoms. This compound features two methyl groups attached to the first and fourth positions of the triazole ring, which influences its chemical reactivity and physical properties. It is typically a colorless to light yellow liquid or solid, depending on its form and purity. The presence of nitrogen atoms in the ring contributes to its potential as a ligand in coordination chemistry and its utility in various synthetic applications. 1,4-Dimethyl-1H-1,2,3-triazole exhibits moderate solubility in polar solvents, making it suitable for various chemical reactions. Its structure allows for hydrogen bonding, which can affect its boiling and melting points. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Overall, 1,4-dimethyl-1H-1,2,3-triazole is a versatile compound with applications in organic synthesis and materials science.
Formula:C4H7N3
InChI:InChI=1S/C4H7N3/c1-4-3-7(2)6-5-4/h3H,1-2H3
InChI key:OJAWOLWHEQUTDE-UHFFFAOYSA-N
SMILES:CC1=CN(N=N1)C
Synonyms:
  • 1,4-dimethyltriazole
  • EOS-61404
  • 1,4-diMethyl-1H-1,2,3-triazole
  • 1H-1,2,3-Triazole, 1,4-dimethyl-
Found 4 products.