CAS 60166-83-8

3-methoxythiophene-2-carboxylic acid

Description:

3-Methoxythiophene-2-carboxylic acid is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a methoxy group (-OCH3) at the 3-position and a carboxylic acid group (-COOH) at the 2-position contributes to its chemical reactivity and solubility properties. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. It is likely to participate in various chemical reactions, including esterification and nucleophilic substitution, owing to the functional groups present. The methoxy group can influence the electronic properties of the thiophene ring, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, 3-methoxythiophene-2-carboxylic acid may have applications in organic synthesis and materials science, particularly in the development of conductive polymers and other advanced materials. Its unique structure and functional groups make it a subject of interest in both academic research and industrial applications.

Formula: C₆H₆O₃S

InChI: InChI=1/C6H6O3S/c1-9-4-2-3-10-5(4)6(7)8/h2-3H,1H3,(H,7,8)

SMILES: COc1ccsc1C(=O)O

3-Methoxythiophene-2-carboxylic acid

CAS: 60166-83-8

Formula: C₆H₆O₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.1750

Ref: IN-DA00EAHE

3-Methoxythiophene-2-carboxylic acid

CAS: 60166-83-8

3-Methoxythiophene-2-carboxylic acid

Formula: C₆H₆O₃S

Purity: 95%

Color and Shape: powder

Molecular weight: 158.18g/mol

Ref: 54-OR2595

3-Methoxythiophene-2-carboxylic acid

CAS: 60166-83-8

Purity: 97%

Molecular weight: 158.1699982

Ref: 10-F694876

3-Methoxythiophene-2-carboxylic acid

CAS: 60166-83-8

3-Methoxythiophene-2-carboxylic acid is a monomer in the synthesis of polyamides. It is an n-terminal amino acid that is involved in the formation of peptide bonds. The methoxy group on this amino acid allows it to be selective for dna sequences, which are unsymmetrical and contain methoxy residues. 3-Methoxythiophene-2-carboxylic acid has been shown to selectively bind dna sequences with a chloro substituent at the 3' position and to have affinities for residue thiophene.

Formula: C₆H₆O₃S

Purity: Min. 95%

Molecular weight: 158.18 g/mol

Ref: 3D-KCA16683