CAS 60172-08-9

N-(pyridin-4-yl)benzene-1,4-diamine

Description:

N-(pyridin-4-yl)benzene-1,4-diamine, also known by its CAS number 60172-08-9, is an organic compound characterized by the presence of both a pyridine and a benzene ring, with amino groups (-NH2) attached to the benzene ring at the 1 and 4 positions. This compound typically appears as a solid and is soluble in polar organic solvents. Its structure allows for potential applications in various fields, including pharmaceuticals and materials science, due to its ability to participate in hydrogen bonding and coordination with metal ions. The presence of the pyridine moiety can enhance its electronic properties, making it useful in organic synthesis and as a ligand in coordination chemistry. Additionally, the amino groups can undergo further chemical modifications, expanding its utility in creating more complex molecules. Safety data should be consulted for handling, as with many amines, it may pose health risks if not managed properly.

Formula: C₁₁H₁₁N₃

InChI: InChI=1/C11H11N3/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11/h1-8H,12H2,(H,13,14)

SMILES: c1cc(ccc1N)N=c1cc[nH]cc1

4(4-Aminophenyl)aminopyridine

Controlled Product

CAS: 60172-08-9

Formula: C₁₁H₁₁N₃

Color and Shape: Neat

Molecular weight: 185.225

Ref: TR-A637883

4(4-Aminophenyl)aminopyridine

CAS: 60172-08-9

Versatile small molecule scaffold

Formula: C₁₁H₁₁N₃

Purity: Min. 95%

Molecular weight: 185.22 g/mol

Ref: 3D-KCA17208