CAS 60174-20-1

1-methoxy-3-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-ol

Description:

1-Methoxy-3-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-ol is a chemical compound characterized by its complex structure, which includes a methoxy group, a propanol moiety, and an imidazole ring with a nitro substituent. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of hydroxyl and methoxy functional groups, which can engage in hydrogen bonding. The nitro group contributes to its potential reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The imidazole ring is known for its role in various biological systems, often acting as a pharmacophore in drug design. Additionally, the presence of the methyl group on the imidazole ring can affect the compound's lipophilicity and overall pharmacokinetic properties. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents.

Formula: C₈H₁₃N₃O₄

InChI: InChI=1/C8H13N3O4/c1-6-9-3-8(11(13)14)10(6)4-7(12)5-15-2/h3,7,12H,4-5H2,1-2H3

SMILES: Cc1ncc(n1CC(COC)O)N(=O)=O

Ro 11-3696

CAS: 60174-20-1

Ro 11-3696 is a bio-active chemical.

Formula: C₈H₁₃N₃O₄

Color and Shape: Solid

Molecular weight: 215.21

Ref: TM-T34342

Ornidazole Impurity 21

CAS: 60174-20-1

Formula: C₈H₁₃N₃O₄

Molecular weight: 215.21

Ref: 4Z-O-1932

Ro 11-3696

CAS: 60174-20-1

Ro 11-3696 is a peptide inhibitor that has been shown to inhibit the activity of protein interactions. It has been used as a research tool to study the structure and function of proteins in cell biology and biochemistry. Ro 11-3696 binds to the ligand binding site of receptor proteins, blocking or activating them. This peptide has also been used to determine the structure and function of ion channels by acting as a ligand in electrophysiological experiments.

Formula: C₈H₁₃N₃O₄

Purity: Min. 95%

Molecular weight: 215.21 g/mol

Ref: 3D-KCA17420

Ornidazole Impurity 21

CAS: 60174-20-1

Formula: C₈H₁₃N₃O₄

Molecular weight: 215.21

Ref: ST-EA-CP-O34017