CAS 60176-19-4

4-(2,5-dimethyl-1H-pyrrol-1-yl)aniline

Description:

4-(2,5-Dimethyl-1H-pyrrol-1-yl)aniline, with the CAS number 60176-19-4, is an organic compound characterized by its structure, which includes an aniline moiety substituted with a pyrrole ring. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in organic synthesis and materials science due to its unique electronic and steric properties. The presence of the dimethyl groups on the pyrrole ring can influence its reactivity and solubility, making it of interest in various chemical reactions. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and UV-Vis spectroscopy, which can be used for its identification and characterization. Its potential biological activity and interactions with other chemical entities could also be a subject of research, particularly in the fields of medicinal chemistry and drug development. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.

Formula: C₁₂H₁₄N₂

InChI: InChI=1/C12H14N2/c1-9-3-4-10(2)14(9)12-7-5-11(13)6-8-12/h3-8H,13H2,1-2H3

SMILES: Cc1ccc(C)n1c1ccc(cc1)N

Synonyms:

• Benzenamine, 4-(2,5-dimethyl-1H-pyrrol-1-yl)-

4-(2,5-Dimethyl-pyrrol-1-yl)-phenylamine

CAS: 60176-19-4

Formula: C₁₂H₁₄N₂

Molecular weight: 186.2530

Ref: IN-DA00EA9S

4-(2,5-Dimethyl-pyrrol-1-yl)-phenylamine

CAS: 60176-19-4

4-(2,5-Dimethyl-pyrrol-1-yl)-phenylamine

Purity: 98%

Molecular weight: 186.25g/mol

Ref: 54-OR951428

4-(2,5-Dimethyl-pyrrol-1-yl)-phenylamine

CAS: 60176-19-4

4-(2,5-Dimethyl-pyrrol-1-yl)-phenylamine is an organic compound that is used as a sensor for benzene. The sensitivity of the sensor can be increased by attaching substituents to the benzene ring. The frequency of the sensor can be measured by atomic force microscopy. The impedance of the sensor can be measured by long-term measurements on a resonant circuit, which also has linearity and hysteresis properties. This compound has high sensitivity and is a good candidate for use in sensors.

Formula: C₁₂H₁₄N₂

Purity: Min. 95%

Molecular weight: 186.26 g/mol

Ref: 3D-KCA17619