CAS 6018-40-2
:Corypalmine
Description:
Corypalmine, with the CAS number 6018-40-2, is an alkaloid primarily derived from the Corydalis species, particularly Corydalis yanhusuo. This compound is known for its potential pharmacological properties, including analgesic and anti-inflammatory effects. Corypalmine exhibits a complex molecular structure, which contributes to its biological activity. It is typically found in the form of a crystalline solid and is characterized by its solubility in organic solvents, while being less soluble in water. The compound interacts with various biological pathways, making it of interest in medicinal chemistry and natural product research. Its safety profile and potential therapeutic applications are subjects of ongoing investigation, particularly in the context of pain management and other health-related benefits. As with many alkaloids, the extraction and purification processes are crucial for obtaining corypalmine in a usable form for research and potential therapeutic use.
Formula:C20H23NO4
InChI:InChI=1/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3
SMILES:COc1ccc2CC3c4cc(c(cc4CCN3Cc2c1OC)O)OC
Synonyms:- Discretinine
- 6H-Dibenzo(a,g)quinolizin-3-ol, 5,8,13,13a-tetrahydro-2,9,10-trimethoxy-, (S)-
- 2,9,10-trimethoxy-5,8,13,13a-tetrahydro-6H-isoquino[3,2-a]isoquinolin-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(-)-Corypalmine
CAS:Corypalmine (IC50=128.0±10.5 uM) can inhibit prolyl oligopeptidase. (-)-Corypalmine shows inhibition activity against spore germination of some fungi.Formula:C20H23NO4Purity:98%Color and Shape:SolidMolecular weight:341.4(-)-Corypalmine
CAS:Please enquire for more information about (-)-Corypalmine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C20H23NO4Molecular weight:341.4 g/mol(+)-Corypalmine
CAS:(+)-Corypalmine is a naturally occurring alkaloid, which is derived from plants in the Corydalis genus, belonging to the Papaveraceae family. This compound is biosynthesized in these plants and has been isolated for its potential pharmacological properties. The mode of action of (+)-Corypalmine involves interaction with various neurotransmitter systems within the body, contributing to a range of bioactivities. It is known to modulate the functions of monoamine transmitters, which are critical in several neurological pathways.
Formula:C20H23NO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:341.4 g/molRef: 3D-FC65352
Discontinued product




