CAS 6018-48-0
:Cytidine, sulfate (2:1) (salt)
Description:
Cytidine sulfate (2:1) (salt), with the CAS number 6018-48-0, is a chemical compound derived from cytidine, a nucleoside that consists of a pyrimidine base (cytosine) and a ribose sugar. This compound is characterized by the presence of sulfate groups, which can influence its solubility and reactivity. Cytidine itself plays a crucial role in biochemistry, particularly in the synthesis of RNA and as a building block for nucleotides. The sulfate modification can enhance its biological activity and stability, making it of interest in various biochemical applications, including potential therapeutic uses. In terms of physical properties, cytidine sulfate is typically a white to off-white solid, soluble in water, and may exhibit hygroscopic behavior. Its chemical structure allows for interactions with other biomolecules, which can be significant in cellular processes. Overall, cytidine sulfate (2:1) (salt) is an important compound in the study of nucleic acids and their derivatives, contributing to our understanding of molecular biology and pharmacology.
Formula:C18H28N6O14S
InChI:InChI=1S/C9H13N3O5.H2O4S/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8;1-5(2,3)4/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16);(H2,1,2,3,4)/t4-,6-,7-,8-;/m1./s1
InChI key:InChIKey=SYPYJHGPUCBHLU-IAIGYFSYSA-N
SMILES:S(=O)(=O)(O)O.O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(N)C=C2
Synonyms:- Cytidine, sulfate (2:1) (salt)
- Cytidine sulfate
- Cytidinium sulfate (2:1)
- Cytidine hemisulfate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cytidine hemisulfate salt
CAS:Cytidine hemisulfate salt is a postulated inhibitor of the blood group antigen. It inhibits the phosphatase activity of blood group-specific phosphatases, which may be caused by its specific inhibition of α-tocopherol and phenolphthalein. Cytidine hemisulfate salt has been shown to inhibit both adenylic and uridylic phosphatases, but does not inhibit other phosphatases. This drug is also an antigen that can stimulate B cells, which produce antibodies against it. Cytidine hemisulfate salt is found in DNA and RNA.Formula:C9H13N3O5H2SO4Purity:Min. 95%Molecular weight:292.26 g/mol


