CAS 60186-33-6

4-(benzyloxy)-3-ethoxybenzaldehyde

Description:

4-(Benzyloxy)-3-ethoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a benzyloxy group and an ethoxy group attached to a benzene ring, contributing to its unique chemical properties. The presence of these substituents influences its reactivity and solubility, making it more hydrophobic due to the bulky benzyloxy group. Typically, compounds like this can exhibit moderate to high stability under standard conditions, but they may be sensitive to strong acids or bases, which can lead to hydrolysis or other reactions. In terms of applications, such compounds are often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to their ability to serve as intermediates in various chemical reactions. Additionally, their structural features may impart specific biological activities, making them of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₆H₁₆O₃

InChI: InChI=1/C16H16O3/c1-2-18-16-10-14(11-17)8-9-15(16)19-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3

SMILES: CCOc1cc(ccc1OCc1ccccc1)C=O

Synonyms:

• Benzaldehyde, 3-ethoxy-4-(phenylmethoxy)-
• Benzaldehyde, 4-benzyloxy-3-ethoxy-
• 4-(Benzyloxy)-3-ethoxybenzaldehyde

4-Benzyloxy-3-ethoxybenzaldehyde

CAS: 60186-33-6

Formula: C₁₆H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 256.2964

Ref: IN-DA00EA6T

4-(Benzyloxy)-3-ethoxybenzaldehyde

CAS: 60186-33-6

4-(Benzyloxy)-3-ethoxybenzaldehyde

Purity: 98%

Molecular weight: 256.29644g/mol

Ref: 54-OR7894

4-Benzyloxy-3-ethoxybenzaldehyde

CAS: 60186-33-6

Formula: C₁₆H₁₆O₃

Purity: 98%

Color and Shape: White powder

Molecular weight: 256.301

Ref: 10-F018222