CAS 60189-44-8
:N-[(2S)-2-aminopropanoyl]-1-(4-nitrophenyl)-L-prolinamide
Description:
N-[(2S)-2-aminopropanoyl]-1-(4-nitrophenyl)-L-prolinamide, with the CAS number 60189-44-8, is a synthetic compound that belongs to the class of proline derivatives. This substance features a proline backbone, which is an amino acid known for its unique cyclic structure, contributing to its conformational flexibility. The presence of a 4-nitrophenyl group introduces significant electronic properties, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. The compound exhibits both hydrophilic and hydrophobic characteristics due to the amino and nitrophenyl functional groups, which can influence its solubility and interaction with biological systems. Additionally, the stereochemistry indicated by the (2S) configuration suggests that it may exhibit specific biological activity, potentially interacting with enzymes or receptors in a chiral-dependent manner. Overall, this compound's unique structural features may make it valuable in research related to drug design and development, particularly in the context of peptide mimetics or enzyme inhibitors.
Formula:C14H18N4O4
InChI:InChI=1/C14H18N4O4/c1-9(15)13(19)16-14(20)12-3-2-8-17(12)10-4-6-11(7-5-10)18(21)22/h4-7,9,12H,2-3,8,15H2,1H3,(H,16,19,20)/t9-,12-/m0/s1
SMILES:C[C@@H](C(=NC(=O)[C@@H]1CCCN1c1ccc(cc1)N(=O)=O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Ala-Pro-pNA
CAS:Very good substrate for the assay of dipeptidyl aminopeptidase IV (DPP IV). It is also hydrolyzed by the thermosensitive dipeptidyl aminopeptidase yscV.Formula:C14H18N4O4Purity:> 99%Color and Shape:Light YellowMolecular weight:306.32H-Ala-Pro-pNA hydrochloride salt
CAS:<p>H-Ala-Pro-pNA hydrochloride salt is a protease inhibitor that is used as a therapeutic agent for the treatment of hepatitis C. It has been shown to inhibit the activity of serine proteases, such as trypsin and chymotrypsin, by binding to their active site. H-Ala-Pro-pNA hydrochloride salt also inhibits the activity of DPPIV (dipeptidyl peptidase IV), which is an enzyme that cleaves the third amino acid from peptides in some blood cells. H-Ala-Pro-pNA hydrochloride salt has been shown to be effective in preventing diabetic nephropathy in animal models by inhibiting DPPIV activity.<br>H-Ala-Pro-pNA hydrochloride salt can be used to treat chronic hepatitis B and C infections. It binds to virus particles and prevents them from attaching themselves to host cells, thus preventing viral replication.</p>Formula:C14H18N4O4Purity:Min. 95%Molecular weight:306.32 g/mol

