CAS 60189-97-1

methyl (2Z)-amino(imino)ethanoate hydrochloride (1:1)

Description:

Methyl (2Z)-amino(imino)ethanoate hydrochloride, with the CAS number 60189-97-1, is a chemical compound that features both amino and imino functional groups, indicating its potential as an intermediate in organic synthesis or as a building block in pharmaceuticals. This compound is typically characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its stability and reactivity. The presence of the methyl ester group suggests that it can undergo hydrolysis to release the corresponding carboxylic acid, while the imino configuration indicates a specific geometric arrangement that can affect its reactivity and interactions with other molecules. Methyl (2Z)-amino(imino)ethanoate hydrochloride may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as melting point, solubility, and spectral characteristics, would be essential for applications in research and development. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₃H₇ClN₂O₂

InChI: InChI=1/C3H6N2O2.ClH/c1-7-3(6)2(4)5;/h1H3,(H3,4,5);1H

SMILES: COC(=O)C(=N)N.Cl

Synonyms:

• 60189-97-1
• Carbomethoxyformamidine HCl

Carbomethoxyformamidine HCl

CAS: 60189-97-1

Formula: C₃H₇ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.5529

Ref: IN-DA00EBAX

Methyl 2-amino-2-iminoacetate hydrochloride

CAS: 60189-97-1

Methyl 2-amino-2-iminoacetate hydrochloride

Purity: 97%

Molecular weight: 138.554g/mol

Ref: 54-OR74224

CARBOMETHOXYFORMAMIDINE HCL

CAS: 60189-97-1

Formula: C₃H₇ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 138.55

Ref: 10-F468971

carbomethoxyformamidine hcl

CAS: 60189-97-1

Versatile small molecule scaffold

Formula: C₃H₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 138.55 g/mol

Ref: 3D-KCA18997