CAS 60196-90-9
:Adapromine
Description:
Adapromine, with the CAS number 60196-90-9, is a chemical compound that belongs to the class of phenylpiperazine derivatives. It is primarily recognized for its potential use in the treatment of various psychiatric disorders, particularly as an antidepressant. The compound exhibits a unique pharmacological profile, acting as a selective serotonin reuptake inhibitor (SSRI), which enhances serotonin levels in the brain, thereby improving mood and emotional balance. Adapromine is characterized by its moderate lipophilicity, which influences its bioavailability and distribution within biological systems. Additionally, it has a relatively low toxicity profile, making it a candidate for therapeutic applications. However, like many psychoactive substances, it may also present side effects, including gastrointestinal disturbances and central nervous system effects. Research into its efficacy and safety continues, as understanding its full pharmacological potential is crucial for its application in clinical settings.
Formula:C13H23N
InChI:InChI=1S/C13H23N/c1-2-12(14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-12H,2-8,14H2,1H3
InChI key:InChIKey=RKPSOUZGYPZAHW-UHFFFAOYSA-N
SMILES:C(CC)(N)C12CC3CC(C1)CC(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decane-1-methanamine, α-ethyl-
- α-Ethyltricyclo[3.3.1.13,7]decane-1-methanamine
- MK 3
- Etandan
- Adapromine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
