
CAS 602-02-8
:1-Chloro-2,3-dinitrobenzene
Description:
1-Chloro-2,3-dinitrobenzene is an aromatic compound characterized by the presence of a chlorine atom and two nitro groups attached to a benzene ring. Its molecular formula is C6H3ClN2O4, and it features a complex structure that contributes to its chemical reactivity and properties. This compound typically appears as a yellow crystalline solid and is known for its relatively high stability under standard conditions. It is primarily used in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the nitro groups makes it a potent electrophile, which can participate in various chemical reactions, including nucleophilic substitutions. Additionally, 1-chloro-2,3-dinitrobenzene is considered hazardous, with potential toxic effects, necessitating careful handling and appropriate safety measures during its use. Its environmental persistence and potential for bioaccumulation also raise concerns regarding its ecological impact.
Formula:C6H3ClN2O4
InChI:InChI=1S/C6H3ClN2O4/c7-4-2-1-3-5(8(10)11)6(4)9(12)13/h1-3H
InChI key:InChIKey=KYDXWCHDUCDNGR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(N(=O)=O)C=CC=C1Cl
Synonyms:- Benzene, 1-chloro-2,3-dinitro-
- 1-Chloro-2,3-dinitrobenzene
- 2,3-Dinitrochlorobenzene
- 2,3-Dinitro-Chlorobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-B-139197
Discontinued product
