CAS 6020-18-4
:Coptisine hydrochloride
Description:
Coptisine hydrochloride is a quaternary ammonium salt derived from the alkaloid coptisine, which is primarily found in various plants, particularly those in the Coptis genus. It is characterized by its yellow crystalline appearance and is soluble in water, which facilitates its use in various biological and pharmacological applications. The compound exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it of interest in medicinal chemistry. Coptisine hydrochloride interacts with various biological targets, influencing cellular processes and signaling pathways. Its chemical structure includes a quaternary nitrogen atom, contributing to its positive charge and solubility profile. As with many alkaloids, it is important to handle coptisine hydrochloride with care, as it may exhibit toxicity at certain concentrations. Research continues to explore its therapeutic potential and mechanisms of action, particularly in the context of traditional medicine and modern pharmacology.
Formula:C19H14NO4·Cl
InChI:InChI=1S/C19H14NO4.ClH/c1-2-16-19(24-10-21-16)14-8-20-4-3-12-6-17-18(23-9-22-17)7-13(12)15(20)5-11(1)14;/h1-2,5-8H,3-4,9-10H2;1H/q+1;/p-1
InChI key:InChIKey=LUXPUVKJHVUJAV-UHFFFAOYSA-M
SMILES:C1=2C=3C(=CC4=C(C3)OCO4)CC[N+]1=CC=5C(C2)=CC=C6C5OCO6.[Cl-]
Synonyms:- 6,7-Dihydro[1,3]Dioxolo[4,5-G][1,3]Dioxolo[7,8]Isoquino[3,2-A]Isoquinolin-5-Ium
- 6,7-Dihydro[1,3]Dioxolo[4,5-G][1,3]Dioxolo[7,8]Isoquino[3,2-A]Isoquinolin-5-Ium Chloride
- 7,12b-dihydro-6H-[1,3]dioxolo[4,5-g][1,3]dioxolo[7,8]isoquino[3,2-a]isoquinoline
- 7,8,13,13a-Tetradehydro-2,3:9,10-bis(methylenedioxy)berbinium chloride
- Berbinium, 7,8,13,13a-tetradehydro-2,3:9,10-bis(methylenedioxy)-, chloride
- Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium, 6,7-dihydro-, chloride
- Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium, 6,7-dihydro-, chloride (1:1)
- Coptisine hydrochloride
- Coptisine chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Coptisine Chloride
CAS:Vegetable alkaloids, natural or reproduced by synthesis, their salts and other derivatives, nesoiFormula:C19H14ClNO4Color and Shape:Orange PowderMolecular weight:355.06114Bis[1,3]benzodioxolo[5,6-a:4',5'-g]quinolizinium, 6,7-dihydro-, chloride
CAS:Formula:C19H14ClNO4Purity:98%Color and Shape:SolidMolecular weight:355.7718Coptisine Chloride
CAS:Formula:C19H14NO4ClPurity:>95.0%(T)(HPLC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:355.77Coptisine chloride
CAS:1. Coptisine chloride (NSC-119754) can be absorbed across intestinal epithelial cells, and completely absorbed compounds.Formula:C19H14ClNO4Purity:98.85% - 99.91%Color and Shape:SolidMolecular weight:355.77Coptisin chloride
CAS:Natural alkaloidFormula:C19H14NO4ClPurity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:355.78Coptisine Chloride
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Coptisine is an alkaloid found in Chinese goldthread (Coptis chinensis). A bacterial collagenase inhibitor. Coptisine has been found to reversibly inhibit Monoamine oxidase A in mice, pointing to a potential role as a natural antidepressant.<br>References Blaney, W., et al.: Physiol. Entomol., 12, 281 (1987), Sethi, M., et al.: J. Pharm. Sci., 72, 538 (1983), Yahara, S., et al.: Chem. Pharm. Bull., 33, 527 (1985),<br></p>Formula:C19H14NO4·ClColor and Shape:NeatMolecular weight:355.77Coptisine chloride
CAS:<p>Coptisine chloride is an isoquinoline alkaloid, which is a naturally occurring compound extracted primarily from plants such as Coptis chinensis, also known as goldthread. This compound is part of a broad class of bioactive molecules prevalent in traditional Chinese medicine. Its mode of action involves the modulation of various biological pathways, including anti-inflammatory, antimicrobial, and anticancer activities. Coptisine chloride acts by interacting with cellular targets that influence gene expression and enzyme activity, thereby exerting its pharmacological effects.</p>Formula:C19H14ClNO4Purity:Min. 95%Molecular weight:355.77 g/molBis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium, 6,7-dihydro-, chloride
CAS:Purity:99%Molecular weight:355.769989
![Bis[1,3]benzodioxolo[5,6-a:4',5'-g]quinolizinium, 6,7-dihydro-, chloride](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA00IKLF.jpg&w=3840&q=75)
![Bis[1,3]benzodioxolo[5,6-a:4′,5′-g]quinolizinium, 6,7-dihydro-, chloride](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F10%2Fthumb%2FF863978.jpg&w=3840&q=75)
