CAS 60208-05-1

2-Bromo-1-(3-bromo-4-methylphenyl)ethanone

Description:

2-Bromo-1-(3-bromo-4-methylphenyl)ethanone is an organic compound characterized by its brominated aromatic structure and ketone functional group. It features a two-carbon ethyl chain attached to a carbonyl group (C=O), with a bromine atom and a substituted phenyl group on one end. The presence of bromine atoms enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the field of pharmaceuticals and agrochemicals. The compound's molecular structure contributes to its physical properties, such as solubility and boiling point, which are influenced by the bromine substituents and the ketone group. Additionally, the compound may exhibit specific biological activities, making it of interest for further research in medicinal chemistry. Safety data should be consulted, as brominated compounds can pose health risks, including toxicity and environmental concerns. Overall, 2-Bromo-1-(3-bromo-4-methylphenyl)ethanone is a notable compound in organic synthesis with potential applications in various chemical industries.

Formula: C₉H₈Br₂O

InChI: InChI=1S/C9H8Br2O/c1-6-2-3-7(4-8(6)11)9(12)5-10/h2-4H,5H2,1H3

InChI key: InChIKey=GITHOLLTLASYCK-UHFFFAOYSA-N

SMILES: C(CBr)(=O)C1=CC(Br)=C(C)C=C1

Synonyms:

• 2-Bromo-1-(3-bromo-4-methylphenyl)ethanone
• Ethanone, 2-bromo-1-(3-bromo-4-methylphenyl)-
• 2-Bromo-1-(3-bromo-4-methylphenyl)ethan-1-one

2-Bromo-1-(3-bromo-4-methyl-phenyl)-ethanone

CAS: 60208-05-1

Formula: C₉H₈Br₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 291.9672

Ref: IN-DA00ELS9

2-Bromo-1-(3-bromo-4-methylphenyl)ethanone

CAS: 60208-05-1

2-Bromo-1-(3-bromo-4-methylphenyl)ethanone

Purity: 97%

Molecular weight: 291.97g/mol

Ref: 54-OR1055297

2-Bromo-1-(3-bromo-4-methylphenyl)ethanone

Controlled Product

CAS: 60208-05-1

Applications 2-Bromo-1-(3-bromo-4-methylphenyl)ethanone is an intermediate in the synthesis of 3-Bromo Zolpidem (B809563). 3-Bromo Zolpidem is an impurity of Zolpidem (Z650000), a selective non-benzodiazepine GABAA receptor agonist. Sedative, hypnotic.
References Arbilla, S., et al.: Arch. Pharmacol., 330, 248 (1985); Cashman, J.N., et al.: Brit. J. Clin. Pharmacol., 21, 205 (1986)

Formula: C₉H₈Br₂O

Color and Shape: Neat

Molecular weight: 291.967

Ref: TR-B997740