CymitQuimica logo

CAS 60221-81-0

:

3-Fluoro-2-methylphenyl isocyanate

Description:
3-Fluoro-2-methylphenyl isocyanate is an organic compound characterized by the presence of an isocyanate functional group (-N=C=O) attached to a substituted aromatic ring. The compound features a fluorine atom and a methyl group on the phenyl ring, which influence its reactivity and physical properties. Typically, isocyanates are known for their high reactivity, particularly with nucleophiles, making them valuable in the synthesis of various polymers, pharmaceuticals, and agrochemicals. The presence of the fluorine atom can enhance the compound's lipophilicity and may affect its biological activity. In terms of physical properties, isocyanates are generally colorless to pale yellow liquids or solids with pungent odors. Safety considerations are crucial when handling this compound, as isocyanates can be irritants and pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate risks associated with its reactivity and potential toxicity.
Formula:C8H6FNO
InChI:InChI=1/C8H6FNO/c1-6-7(9)3-2-4-8(6)10-5-11/h2-4H,1H3
InChI key:OXJRWBPYWYAGNW-UHFFFAOYSA-N
SMILES:Cc1c(cccc1N=C=O)F
Synonyms:
  • 1-Fluoro-3-isocyanato-2-methylbenzene
Found 4 products.