CAS 602261-92-7

1-(Isocyanomethyl)-2-methoxybenzene

Description:

1-(Isocyanomethyl)-2-methoxybenzene, with the CAS number 602261-92-7, is an organic compound characterized by the presence of both isocyanomethyl and methoxy functional groups attached to a benzene ring. This compound typically exhibits a molecular structure that includes a methoxy group (-OCH3) at the 2-position and an isocyanomethyl group (-CH2N=C=O) at the 1-position of the benzene ring. The presence of the isocyanate functional group imparts reactivity, particularly in nucleophilic addition reactions, making it useful in various synthetic applications. The methoxy group contributes to the compound's solubility in organic solvents and can influence its electronic properties, potentially affecting reactivity and stability. Additionally, the compound may exhibit moderate to low toxicity, and appropriate safety measures should be taken when handling it. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, where it may serve as an intermediate in the synthesis of more complex molecules.

Formula: C₉H₉NO

InChI: InChI=1S/C9H9NO/c1-10-7-8-5-3-4-6-9(8)11-2/h3-6H,7H2,2H3

InChI key: InChIKey=NSFTVQFJYCRFKI-UHFFFAOYSA-N

SMILES: C([N+]#[C-])C1=C(OC)C=CC=C1

Synonyms:

• 2-Methoxybenzyl isocyanide
• 1-(Isocyanomethyl)-2-methoxybenzene
• Benzene, 1-(isocyanomethyl)-2-methoxy-

1-(Isocyanomethyl)-2-methoxybenzene

CAS: 602261-92-7

1-(Isocyanomethyl)-2-methoxybenzene is a reactive compound that can be used to make other chemicals. It is a member of the homodinuclear class of compounds, which means that it has only one type of atom in each molecule. This compound can be used to make polymers and plastics, as well as other chemicals. The reactivity of this compound is due to its ability to bind metal ions, such as copper and zinc, which are important for many chemical reactions. 1-(Isocyanomethyl)-2-methoxybenzene has been shown to react with x-rays in the diffraction technique.

Formula: C₉H₉NO

Purity: Min. 95%

Molecular weight: 147.17 g/mol

Ref: 3D-CZA26192