CAS 602262-06-6
:1-(3-Isocyanopropoxy)butane
Description:
1-(3-Isocyanopropoxy)butane is an organic compound characterized by the presence of both an isocyanate functional group and an ether linkage. The molecular structure features a butane backbone with a propoxy group attached to the isocyanate, which contributes to its reactivity and potential applications in various chemical processes. Isocyanates are known for their ability to react with nucleophiles, making this compound useful in the synthesis of polyurethanes and other polymers. The ether portion of the molecule can enhance solubility in organic solvents and may influence the compound's physical properties, such as boiling point and viscosity. Additionally, the presence of the isocyanate group suggests that the compound may be hazardous, as isocyanates can be irritants and sensitizers. Proper handling and safety precautions are essential when working with this substance. Overall, 1-(3-Isocyanopropoxy)butane is a versatile compound with significant implications in materials science and industrial chemistry.
Formula:C8H15NO
InChI:InChI=1/C8H15NO/c1-3-4-7-10-8-5-6-9-2/h3-8H2,1H3
InChI key:InChIKey=WITMFOURWMAKTG-UHFFFAOYSA-N
SMILES:C(OCCCC)CC[N+]#[C-]
Synonyms:- 3-Butoxypropyl isocyanide
- Butane, 1-(3-isocyanopropoxy)-
- 1-(3-Isocyanopropoxy)butane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.