CAS 602303-26-4

7-Chloro-2-iodothieno[3,2-b]pyridine

Description:

7-Chloro-2-iodothieno[3,2-b]pyridine is a heterocyclic compound characterized by its unique structure, which includes a thieno[3,2-b]pyridine core. This compound features a chlorine atom at the 7-position and an iodine atom at the 2-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of halogens, such as chlorine and iodine, often enhances the compound's biological activity and can influence its pharmacokinetic properties. The thieno[3,2-b]pyridine framework is known for its role in various biological activities, making derivatives of this compound of interest in drug discovery. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the aromatic ring, which may affect its interactions with biological targets. Overall, 7-Chloro-2-iodothieno[3,2-b]pyridine represents a valuable scaffold for the development of new therapeutic agents, particularly in the fields of oncology and infectious diseases.

Formula: C₇H₃ClINS

InChI: InChI=1/C7H3ClINS/c8-4-1-2-10-5-3-6(9)11-7(4)5/h1-3H

SMILES: c1cnc2cc(I)sc2c1Cl

Synonyms:

• Thieno[3,2-b]pyridine, 7-chloro-2-iodo-

7-Chloro-2-iodothieno[3,2-b]pyridine

CAS: 602303-26-4

Formula: C₇H₃ClINS

Purity: 98%

Color and Shape: Solid

Molecular weight: 295.5279

Ref: IN-DA0037GC

7-chloro-2-iodothieno[3,2-b]pyridine

CAS: 602303-26-4

7-chloro-2-iodothieno[3,2-b]pyridine

Purity: 97%

Molecular weight: 295.53g/mol

Ref: 54-OR94019

7-Chloro-2-iodothieno[3,2-b]pyridine

CAS: 602303-26-4

Formula: C₇H₃ClINS

Purity: 98%

Color and Shape: Solid

Molecular weight: 295.52

Ref: 10-F067592