CAS 602307-22-2

3',5'-bis(trifluoromethyl)biphenyl-4-carbaldehyde

Description:

3',5'-bis(trifluoromethyl)biphenyl-4-carbaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two trifluoromethyl groups (-CF3) at the 3' and 5' positions significantly influences its chemical properties, enhancing its electron-withdrawing characteristics and making it a highly lipophilic compound. The aldehyde functional group (-CHO) at the 4-position contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and condensation reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic properties and structural features make it of interest in materials science and medicinal chemistry. Additionally, due to the presence of fluorine atoms, it may exhibit distinct thermal and chemical stability compared to non-fluorinated analogs. Safety data should be consulted for handling and usage, as fluorinated compounds can pose specific health and environmental risks.

Formula: C₁₅H₈F₆O

InChI: InChI=1/C15H8F6O/c16-14(17,18)12-5-11(6-13(7-12)15(19,20)21)10-3-1-9(8-22)2-4-10/h1-8H

SMILES: c1cc(ccc1C=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F

Synonyms:

• [1,1'-Biphenyl]-4-Carboxaldehyde, 3',5'-Bis(Trifluoromethyl)-
• 3',5'-Bis(trifluoromethyl)biphenyl-4-carbaldehyde

4-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]BENZALDEHYDE

CAS: 602307-22-2

Formula: C₁₅H₈F₆O

Purity: 95.0%

Molecular weight: 318.218

Ref: 10-F306169