CAS 602329-51-1

4-(7-hydroxy-4-oxo-4H-chromen-3-yl)phenyl hexanoate

Description:

4-(7-hydroxy-4-oxo-4H-chromen-3-yl)phenyl hexanoate, with the CAS number 602329-51-1, is a chemical compound that belongs to the class of flavonoids, specifically a derivative of coumarin. This substance features a chromenone structure, characterized by a benzopyran ring fused with a carbonyl group, which contributes to its potential biological activities. The presence of the hexanoate moiety indicates that it is an ester, which can influence its solubility and reactivity. The hydroxyl group on the chromenone structure may impart antioxidant properties, making it of interest in various fields, including pharmaceuticals and nutraceuticals. Additionally, the compound may exhibit UV-absorbing properties, which can be beneficial in cosmetic applications. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure suggests potential applications in medicinal chemistry and functional materials.

Formula: C₂₁H₂₀O₅

InChI: InChI=1/C21H20O5/c1-2-3-4-5-20(23)26-16-9-6-14(7-10-16)18-13-25-19-12-15(22)8-11-17(19)21(18)24/h6-13,22H,2-5H2,1H3

SMILES: CCCCCC(=O)Oc1ccc(cc1)c1coc2cc(ccc2c1=O)O

4’-O-Hexanoyldaidzein

Controlled Product

CAS: 602329-51-1

Applications An intermediate for the synthesis of Daidzein 7-O-Glucuronides.
References Al-Maharik, N., et al.: Tetrahedron Lett., 47, 8703 (2006).

Formula: C₂₁H₂₀O₅

Color and Shape: Neat

Molecular weight: 352.38

Ref: TR-H294450

4'-O-Hexanoyldaidzein

CAS: 602329-51-1

4'-O-Hexanoyldaidzein is a chemically modified isoflavone, which is a derivative of daidzein. This compound is sourced from soybeans, renowned for being rich in naturally occurring isoflavones. The modification entails the addition of a hexanoyl group to the daidzein molecule, altering its physicochemical properties and potentially enhancing its biological activity.

Formula: C₂₁H₂₀O₅

Purity: Min. 95%

Molecular weight: 352.38 g/mol

Ref: 3D-FH23814

4\'-O-Hexanoyldaidzein

CAS: 602329-51-1

Formula: C₂₁H₂₀O₅

Molecular weight: 352.38

Ref: ST-EA-CP-D139004