CAS 60239-18-1: DOTA
Description:DOTA, or 1,4,7,10-tetraazacyclododecane-N,N',N'',N'''-tetraacetic acid, is a polyaminocarboxylic acid that serves as a chelating agent, particularly in coordination chemistry and radiopharmaceutical applications. Its structure features a cyclic framework with four nitrogen atoms and four carboxylic acid groups, allowing it to effectively bind metal ions, such as gallium, indium, and lutetium. DOTA is known for its stability and ability to form strong complexes, making it valuable in medical imaging and targeted radiotherapy. The compound is typically used in the labeling of biomolecules for positron emission tomography (PET) and single-photon emission computed tomography (SPECT). DOTA's solubility in water and compatibility with biological systems enhance its utility in various biochemical applications. Additionally, its ability to form stable complexes with radionuclides allows for precise targeting in cancer treatment, highlighting its significance in both research and clinical settings. Overall, DOTA is a versatile compound with important implications in the fields of chemistry, medicine, and radiopharmaceutical development.
Formula:C16H28N4O8
InChI:InChI=1S/C16H28N4O8/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28)
InChI key:InChIKey=WDLRUFUQRNWCPK-UHFFFAOYSA-N
SMILES:O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1
- Synonyms:
- 1,4,7,10-Tetra(carboxymethyl)-1,4,7,10-tetraazacyclododecane
- 1,4,7,10-Tetraazacyclodecane-1,4,7,10-tetraacetic acid
- 1,4,7,10-Tetraazacyclododecane-N,N′,N′′,N′′′-tetraacetic acid
- 2,2',2'',2'''-(1,4,7,10-Tetraazacyclododecane-1,4,7,10-Tetrayl)Tetraacetic Acid
- 2-[4,7,10-Tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid
- Dota
- NSC 681107
- Tetraxetan
- 1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetraacetic acid
