CAS 60240-16-6

H-Ala-Phe-NH2 . HCl

Description:

The chemical substance "H-Ala-Phe-NH2·HCl," also known as hydrochloride of the dipeptide composed of alanine (Ala) and phenylalanine (Phe), is characterized by its structure, which includes an amino group (NH2), a carboxylic acid group (COOH), and a side chain specific to each amino acid. The presence of hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound is typically used in biochemical research and pharmaceutical applications due to its role in protein synthesis and potential therapeutic properties. It exhibits properties common to peptides, such as being sensitive to hydrolysis and having specific interactions with biological receptors. The molecular weight and specific physical properties, such as melting point and solubility, can vary based on the conditions and purity of the sample. Overall, H-Ala-Phe-NH2·HCl serves as a valuable compound in studies related to peptide chemistry and biological functions.

Formula: C₁₂H₁₈ClN₃O₂

InChI: InChI=1/C12H17N3O2.ClH/c1-8(13)12(17)15-10(11(14)16)7-9-5-3-2-4-6-9;/h2-6,8,10H,7,13H2,1H3,(H2,14,16)(H,15,17);1H

SMILES: CC(C(=NC(Cc1ccccc1)C(=N)O)O)N.Cl

Synonyms:

• H-Ala-Phe-Nh2 Hcl

H-Ala-Phe-NH2·HCl

CAS: 60240-16-6

Please enquire for more information about H-Ala-Phe-NH2·HCl including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₇N₃O₂·HCl

Purity: Min. 95%

Molecular weight: 271.74 g/mol

Ref: 3D-FA107975