CAS 60249-09-4

Thieno[3,2-c]pyridine-6-carboxylic acid

Description:

Thieno[3,2-c]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its fused thieno and pyridine rings, which contribute to its unique chemical properties. The presence of a carboxylic acid functional group at the 6-position enhances its acidity and reactivity, making it a valuable intermediate in organic synthesis. This compound typically exhibits moderate solubility in polar solvents due to the polar nature of the carboxylic acid group, while its aromatic structure may provide some degree of stability and hydrophobic interactions. Thieno[3,2-c]pyridine derivatives are of interest in medicinal chemistry, as they can exhibit biological activity, including potential anti-inflammatory and antimicrobial properties. The compound's structure allows for various substitution patterns, which can be explored to modify its pharmacological profile. Additionally, its unique electronic properties, stemming from the conjugated system of the fused rings, may facilitate interactions with biological targets, making it a subject of research in drug development and material science.

Formula: C₈H₅NO₂S

InChI: InChI=1S/C8H5NO2S/c10-8(11)6-3-7-5(4-9-6)1-2-12-7/h1-4H,(H,10,11)

InChI key: InChIKey=SJOJSVUJOMBMRX-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=CN1)C=CS2

Synonyms:

• Thieno[3,2-c]pyridine-6-carboxylic acid

Thieno[3,2-c]pyridine-6-carboxylic acid

CAS: 60249-09-4

Versatile small molecule scaffold

Formula: C₈H₅NO₂S

Purity: Min. 95%

Molecular weight: 179.2 g/mol

Ref: 3D-KCA24909