CAS 6025-69-0

4-Chloropyrrolo[1,2-a]quinoxaline

Description:

4-Chloropyrrolo[1,2-a]quinoxaline is a heterocyclic compound characterized by its fused pyrrole and quinoxaline rings, with a chlorine substituent at the fourth position of the pyrrole moiety. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activities, including antimicrobial and anticancer properties. Its molecular structure contributes to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The presence of the chlorine atom can influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, 4-Chloropyrrolo[1,2-a]quinoxaline may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic additions, due to the electron-rich nature of the pyrrole ring. As a compound with a specific CAS number, it is cataloged for regulatory and research purposes, facilitating its identification and study in various scientific fields, including organic synthesis and drug development.

Formula: C₁₁H₇ClN₂

InChI: InChI=1S/C11H7ClN2/c12-11-10-6-3-7-14(10)9-5-2-1-4-8(9)13-11/h1-7H

InChI key: InChIKey=JCMYTAKENOIBNF-UHFFFAOYSA-N

SMILES: ClC=1C=2N(C=3C(N1)=CC=CC3)C=CC2

Synonyms:

• 4-Chloropyrrolo[1,2-a]quinoxaline
• 6-Chloropyrrolo[1,2a]quinoxaline
• Pyrrolo[1,2-a]quinoxaline, 4-chloro-

4-Chloropyrrolo[1,2-a]quinoxaline

CAS: 6025-69-0

Formula: C₁₁H₇ClN₂

Molecular weight: 202.6397

Ref: IN-DA00ER67

4-chloropyrrolo[1,2-a]quinoxaline

CAS: 6025-69-0

4-chloropyrrolo[1,2-a]quinoxaline

Purity: ≥95%

Ref: 54-OR29297

4-Chloropyrrolo[1,2-a]quinoxaline

CAS: 6025-69-0

4-Chloropyrrolo[1,2-a]quinoxaline is an organic compound that is used in the synthesis of other drugs. It is a chiral molecule that can be derived from the natural product quinoxaline. 4-Chloropyrrolo[1,2-a]quinoxaline has been shown to inhibit efflux proteins in mammalian cells and to inhibit the kinase activity of hepg2 cell lines. These effects may be due to its ability to bind to the ATP binding site of these enzymes and prevent ATP hydrolysis. 4-Chloropyrrolo[1,2-a]quinoxaline has been shown to bind selectively with protein kinases and has antimalarial activity against Plasmodium falciparum, a parasite that causes malaria.

Formula: C₁₁H₇ClN₂

Purity: Min. 95%

Molecular weight: 202.64 g/mol

Ref: 3D-GAA02569