CAS 60262-81-9
:benzo[pqr]tetraphen-3-yl beta-D-glucopyranosiduronic acid
Description:
Benzo[pqr]tetraphen-3-yl beta-D-glucopyranosiduronic acid, identified by the CAS number 60262-81-9, is a complex organic compound characterized by its unique structural features. This substance is a derivative of glucuronic acid, which is a sugar acid that plays a crucial role in the detoxification processes in biological systems. The presence of the benzo[pqr]tetraphenyl moiety indicates a polycyclic aromatic structure, which may contribute to its potential biological activity and interactions. The beta-D-glucopyranosiduronic acid component suggests that the compound can participate in various biochemical pathways, particularly in conjugation reactions where it may facilitate the excretion of hydrophobic compounds. Its solubility, stability, and reactivity can be influenced by the functional groups present in the molecule, making it of interest in fields such as medicinal chemistry and biochemistry. Overall, this compound's unique structure and properties may offer insights into its potential applications in drug development and therapeutic uses.
Formula:C26H20O7
InChI:InChI=1/C26H20O7/c27-21-22(28)24(25(30)31)33-26(23(21)29)32-18-10-7-12-5-8-16-15-4-2-1-3-13(15)11-14-6-9-17(18)19(12)20(14)16/h1-11,21-24,26-29H,(H,30,31)/t21-,22-,23+,24-,26+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Hydroxy Benzopyrene O-b-D-glucuronide
CAS:Controlled Product<p>Applications 3-Hydroxy Benzopyrene O-β-D-glucuronide is the glucuronide conjugate and metabolite of the carcinogen Benzopyrene (B205800).<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Bevan, D.R. et al.: Carcinogensis, 13, 403 (1992); Nishimoto, M. et al.: Xenobiotica, 22, 949 (1992);Zheng, Z. et al.: Drug Metab. Dispos., 30,397 (2002);<br></p>Formula:C26H20O7Color and Shape:Light Yellow To Dark YellowMolecular weight:444.433-Hydroxy Benzopyrene-d11−β-D-glucuronide
CAS:Controlled ProductFormula:C26D11H9O7Color and Shape:NeatMolecular weight:455.501
