CAS 60267-34-7
:L-lysyl-3-(4H-imidazol-4-yl)-L-alanylglycinamide
Description:
L-lysyl-3-(4H-imidazol-4-yl)-L-alanylglycinamide, with the CAS number 60267-34-7, is a synthetic peptide that features a combination of amino acids and an imidazole ring, which contributes to its unique properties. This compound is characterized by its potential biological activity, particularly in the context of peptide synthesis and medicinal chemistry. The presence of the imidazole moiety may impart specific interactions with biological targets, making it of interest in pharmacological research. The structure includes lysine and alanine residues, which can influence its solubility, stability, and interaction with other biomolecules. Additionally, the glycinamide component may enhance its ability to form hydrogen bonds, further affecting its biological function. Overall, this compound is likely to be studied for its potential applications in drug development, particularly in areas related to peptide therapeutics and biochemistry. However, detailed studies on its specific biological activities and mechanisms of action would be necessary to fully understand its potential uses.
Formula:C14H25N7O3
InChI:InChI=1/C14H25N7O3/c15-4-2-1-3-10(16)13(23)21-11(5-9-6-18-8-20-9)14(24)19-7-12(17)22/h6,8-11H,1-5,7,15-16H2,(H2,17,22)(H,19,24)(H,21,23)/t9?,10-,11-/m0/s1
SMILES:C(CCN)C[C@@H](C(=N[C@@H](CC1C=NC=N1)C(=NCC(=N)O)O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(S)-2,6-Diamino-N-((S)-1-((2-amino-2-oxoethyl)amino)-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)hexanamide
CAS:(S)-2,6-Diamino-N-((S)-1-((2-amino-2-oxoethyl)amino)-3-(1H-imidazol-4-yl)-1-oxopropan-2-yl)hexanamidePurity:99%Molecular weight:339.4g/molBursin (avian)
CAS:Bursin is a vaccine that is used to prevent the infection of avian influenza in chickens. It has been shown to stimulate antibody production and increase the immune response in chickens. Bursin consists of an amino terminal, carboxy terminal, and a peptide sequence that binds to receptors on the surface of cells. Peptides such as bursin are used for sample preparation or expression plasmids in tissue culture experiments. Bursin also has calcium-binding properties and can be used as a histochemical stain for skin cells. The hydroxyl group on the side chain is important for its function.Formula:C14H25N7O3Purity:Min. 95%Molecular weight:339.39 g/mol
