CAS 60283-31-0
:2-(acetylamino)-2-deoxy-3-O-hexopyranosylhexopyranose
Description:
2-(Acetylamino)-2-deoxy-3-O-hexopyranosylhexopyranose, also known by its CAS number 60283-31-0, is a glycosylated amino sugar that features both acetylamino and hexopyranosyl moieties. This compound is characterized by its structural complexity, comprising multiple sugar units linked through glycosidic bonds. The presence of the acetylamino group suggests that it may exhibit biological activity, potentially influencing interactions with proteins or other biomolecules. Its hexopyranosyl components indicate that it is derived from hexose sugars, which are common in nature and play crucial roles in cellular processes. The compound is likely to be soluble in polar solvents due to its hydroxyl groups, and it may participate in hydrogen bonding, affecting its reactivity and stability. Additionally, its structural features may allow it to serve as a substrate or inhibitor in enzymatic reactions, making it of interest in biochemical research and potential pharmaceutical applications. Overall, this compound exemplifies the intricate chemistry of carbohydrates and their derivatives in biological systems.
Formula:C14H25NO11
InChI:InChI=1/C14H25NO11/c1-4(18)15-7-12(9(20)6(3-17)24-13(7)23)26-14-11(22)10(21)8(19)5(2-16)25-14/h5-14,16-17,19-23H,2-3H2,1H3,(H,15,18)
SMILES:CC(=NC1C(C(C(CO)OC1O)O)OC1C(C(C(C(CO)O1)O)O)O)O
Synonyms:- hexopyranose, 2-(acetylamino)-2-deoxy-3-O-hexopyranosyl-
- 2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactopyranose
CAS:2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactopyranose is a high purity, custom synthesis sugar that is modified with fluorination, glycosylation, and methylation. It has the CAS number 60283-31-0 and can be used in the modification of oligosaccharides and monosaccharides. This carbohydrate can be found in complex carbohydrates.Formula:C14H25NO11Purity:Min. 95%Color and Shape:White PowderMolecular weight:383.35 g/mol2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactopyranose
CAS:2-Acetamido-2-deoxy-3-O-(a-D-galactopyranosyl)-D-galactopyranose is a high purity synthetic oligosaccharide. It is an off white to light yellow powder with a molecular weight of 514.06 and a melting point of >200 degrees Celsius. The chemical formula for this product is C12H24O11N2. This product has been fluorinated, methylated, glycosylated, and click modified to create a complex carbohydrate that can be used in the synthesis of other molecules.Formula:C14H25NO11Purity:Min. 90.0 Area-%Molecular weight:383.35 g/mol

