CymitQuimica logo

CAS 60288-22-4

:

2-(2,5-dimethylbenzoyl)benzoic acid

Description:
2-(2,5-Dimethylbenzoyl)benzoic acid, with the CAS number 60288-22-4, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidic properties, and a 2,5-dimethylbenzoyl group that enhances its hydrophobic characteristics. This compound typically appears as a solid at room temperature and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic nature. The presence of the carboxylic acid group (-COOH) allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. It may be utilized in various applications, including as a photoinitiator in polymer chemistry and in the synthesis of other organic compounds. Additionally, its structural features may impart specific optical properties, making it of interest in materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H14O3
InChI:InChI=1/C16H14O3/c1-10-7-8-11(2)14(9-10)15(17)12-5-3-4-6-13(12)16(18)19/h3-9H,1-2H3,(H,18,19)
SMILES:Cc1ccc(C)c(c1)C(=O)c1ccccc1C(=O)O
Synonyms:
  • 2-(2,5-Dimethyl-benzoyl)-benzoic acid
Found 0 products.