CAS 6029-26-1
:8a-(4-Chlorophenyl)hexahydropyrrolo[1,2-a]pyrimidin-6(2H)-one
Description:
8a-(4-Chlorophenyl)hexahydropyrrolo[1,2-a]pyrimidin-6(2H)-one, with the CAS number 6029-26-1, is a chemical compound characterized by its complex bicyclic structure, which includes a pyrimidinone moiety fused to a hexahydropyrrole ring. This compound features a 4-chlorophenyl substituent, contributing to its potential biological activity and influencing its physicochemical properties. Typically, compounds of this nature may exhibit a range of biological activities, including potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The presence of the chlorophenyl group can enhance lipophilicity, affecting solubility and permeability, which are critical for drug design. Additionally, the compound's stereochemistry and functional groups may play significant roles in its reactivity and interaction with biological targets. Overall, 8a-(4-Chlorophenyl)hexahydropyrrolo[1,2-a]pyrimidin-6(2H)-one represents a class of compounds that may be of interest for further research in medicinal chemistry and pharmacology.
Formula:C13H15ClN2O
InChI:InChI=1S/C13H15ClN2O/c14-11-4-2-10(3-5-11)13-7-6-12(17)16(13)9-1-8-15-13/h2-5,15H,1,6-9H2
InChI key:InChIKey=ISVGLFPWWZUOQR-UHFFFAOYSA-N
SMILES:O=C1N2C(CC1)(NCCC2)C3=CC=C(Cl)C=C3
Synonyms:- 8a-(4-Chlorophenyl)hexahydropyrrolo[1,2-a]pyrimidin-6(2H)-one
- Pyrrolo[1,2-a]pyrimidin-6(2H)-one, 8a-(4-chlorophenyl)hexahydro-
- Pyrrolo[1,2-a]pyrimidin-6(2H)-one, 8a-(p-chlorophenyl)hexahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.