CymitQuimica logo

CAS 60299-77-6

:

(3E)-2-oxo-4-phenylbut-3-enenitrile

Description:
(3E)-2-oxo-4-phenylbut-3-enenitrile, with the CAS number 60299-77-6, is an organic compound characterized by its unique structural features. It contains a conjugated system with a double bond, a carbonyl group (ketone), and a nitrile functional group, which contribute to its reactivity and potential applications in organic synthesis. The presence of the phenyl group enhances its aromatic characteristics, influencing its electronic properties and stability. This compound is typically a yellow to brown solid at room temperature and is soluble in organic solvents. Its reactivity can be attributed to the electrophilic nature of the carbonyl group and the nucleophilic potential of the nitrile, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the compound's geometric configuration (E-isomer) indicates the specific arrangement of substituents around the double bond, which can affect its biological activity and interaction with other molecules. Overall, (3E)-2-oxo-4-phenylbut-3-enenitrile is a versatile compound with significant implications in chemical research and industry.
Formula:C10H7NO
InChI:InChI=1/C10H7NO/c11-8-10(12)7-6-9-4-2-1-3-5-9/h1-7H/b7-6+
Synonyms:
  • (3E)-2-Oxo-4-phenyl-3-butenenitrile
  • (3E)-2-Oxo-4-phenyl-3-butenonitril
  • 3-butenenitrile, 2-oxo-4-phenyl-, (3E)-
  • (3E)-2-Oxo-4-phenylbut-3-enenitrile
Found 1 products.