CAS 603-12-3

2,6-Dinitrobenzoic acid

Description:

2,6-Dinitrobenzoic acid is an aromatic compound characterized by the presence of two nitro groups (-NO2) and a carboxylic acid group (-COOH) attached to a benzene ring. Its molecular formula is C7H4N2O4, and it features a benzoic acid structure with nitro substituents at the 2 and 6 positions. This compound is typically a yellow crystalline solid, exhibiting moderate solubility in organic solvents and limited solubility in water. 2,6-Dinitrobenzoic acid is known for its acidic properties, with a pKa that indicates its ability to donate protons in solution. It is often used in organic synthesis, particularly in the preparation of various derivatives and as a reagent in chemical reactions. Additionally, due to the presence of nitro groups, it can participate in electrophilic aromatic substitution reactions. Safety precautions are necessary when handling this compound, as it may pose health risks and environmental hazards.

Formula: C₇H₄N₂O₆

InChI: InChI=1/C7H4N2O6/c10-7(11)6-4(8(12)13)2-1-3-5(6)9(14)15/h1-3H,(H,10,11)

SMILES: c1cc(c(c(c1)N(=O)=O)C(=O)O)N(=O)=O

Synonyms:

• Benzoic acid, 2,6-dinitro-

2,6-Dinitrobenzoic acid

CAS: 603-12-3

Formula: C₇H₄N₂O₆

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.1165

Ref: IN-DA003G5Z

2,6-Dinitrobenzoic acid

CAS: 603-12-3

2,6-Dinitrobenzoic acid

Purity: 95%

Molecular weight: 212.12g/mol

Ref: 54-OR1044179

2,6-Dinitrobenzoic acid

CAS: 603-12-3

Purity: >95%

Molecular weight: 212.1170044

Ref: 10-F774881

2,6-Dinitrobenzoic Acid

Controlled Product

CAS: 603-12-3

Formula: C₇H₄N₂O₆

Color and Shape: Neat

Molecular weight: 212.117

Ref: TR-D680188