CAS 603-71-4
:Nitromesitylene
Description:
Nitromesitylene, with the CAS number 603-71-4, is an organic compound classified as a nitroaromatic compound. It is characterized by its structure, which includes a mesitylene backbone (a derivative of toluene with three methyl groups) substituted with nitro groups. Specifically, nitromesitylene features two nitro groups attached to the aromatic ring, which significantly influences its chemical properties. This compound is typically a yellow crystalline solid and is known for its stability and relatively low volatility. It is insoluble in water but soluble in organic solvents, making it useful in various chemical applications. Nitromesitylene is primarily utilized in the synthesis of other chemical compounds and as an intermediate in the production of explosives and dyes. Its nitro groups contribute to its reactivity, particularly in electrophilic substitution reactions. Additionally, due to its potential environmental and health impacts, handling nitromesitylene requires appropriate safety measures to mitigate exposure risks.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-6-4-7(2)9(10(11)12)8(3)5-6/h4-5H,1-3H3
InChI key:InChIKey=SCEKDQTVGHRSNS-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C=C(C)C=C1C
Synonyms:- 1,3,5-Trimethyl-2-Nitrobenzene
- 1-Nitro-2,4,6-trimethylbenzene
- 2,4,6-Trimethyl-1-nitrobenzene
- 2,4,6-Trimethylnitrobenzene
- 2-Nitro-1,3,5-trimethylbenzene
- 3,5-Dimethyl-4-nitrotoluene
- Benzene, 1,3,5-Trimethyl-2-Nitro-
- Mesitylene, 2-nitro-
- Mononitromesitylene
- NSC 5413
- Nitromesitylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Nitromesitylene
CAS:<p>2-Nitromesitylene is a nitro compound that is reactive with diazonium salts and hydrochloric acid. It has been shown to have the potential to produce reactive oxygen species (ROS) like superoxide and hydroxyl radicals. 2-Nitromesitylene has been shown to inhibit the production of TNF-α in mice. This chemical also produces redox potentials, which are measured in millivolts, and is used as a kinetic data for reaction solutions. 2-Nitromesitylene can be synthesized by reacting trifluoroacetic acid with an inorganic acid and electrochemical impedance spectroscopy can be used to measure the electron transfer reactions of this chemical. The x-ray crystal structures of 2-nitromesitylene show that it binds to the active site of autoimmune diseases enzymes such as acetylcholinesterase and carboxypeptidase A2, inhibiting their activity.</p>Formula:C9H11NO2Purity:Min. 94%Color and Shape:PowderMolecular weight:165.19 g/mol
