CAS 603-81-6
:2,3-Diaminobenzoic acid
Description:
2,3-Diaminobenzoic acid, with the CAS number 603-81-6, is an aromatic amine and a derivative of benzoic acid. It features two amino groups (-NH2) positioned at the 2 and 3 carbon atoms of the benzene ring, which contributes to its basicity and reactivity. This compound is typically a white to off-white crystalline solid that is soluble in water and polar organic solvents, owing to the presence of the amino groups. It exhibits properties such as being a potential intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. Additionally, 2,3-diaminobenzoic acid can participate in various chemical reactions, including acylation and coupling reactions, making it valuable in organic synthesis. Its biological significance includes potential applications in medicinal chemistry, particularly in the development of antibacterial agents. However, as with many amines, it may pose health risks if not handled properly, necessitating appropriate safety measures during use.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,8-9H2,(H,10,11)
InChI key:InChIKey=KKTUQAYCCLMNOA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C(N)=CC=C1
Synonyms:- 2,3-Diaminobenzonicacid
- 3-Carboxy-1,2-Diaminobenzene
- 3-Carboxy-o-phenylenediamine
- Benzoic acid,2,3-diamino-
- 2,3-Diaminobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3-Diaminobenzoic acid
CAS:2,3-Diaminobenzoic acidFormula:C7H8N2O2Purity:99%Color and Shape: very dark brown solidMolecular weight:152.15g/mol2,3-Diaminobenzoic acid
CAS:<p>2,3-Diaminobenzoic acid is a benzimidazole derivative that is used in the treatment of microbial infections. It has been shown to inhibit the growth of bacteria by binding to their ribosomes and inhibiting protein synthesis. The reaction solution of 2,3-diaminobenzoic acid has fluorescence properties that can be used to detect contaminating substances. The conjugates formed with p-hydroxyphenylacetic acid are more soluble than those formed with hydroxybenzoic acid. 2,3-Diaminobenzoic acid is not very toxic and does not cause any detectable changes in enzyme activities or other biochemical parameters in short term exposure. It can be easily decomposed by sodium chloride into chlorine gas and hydrochloric acid, which are both highly reactive with water.</p>Formula:C7H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol


