CAS 60301-87-3
:2-(N-hexadecanoylamino)-4-nitrophenol
Description:
2-(N-hexadecanoylamino)-4-nitrophenol, with the CAS number 60301-87-3, is a chemical compound characterized by its structure, which includes a nitrophenol moiety and a hexadecanoyl (fatty acid) amine group. This compound typically exhibits properties associated with both hydrophilic and hydrophobic regions, making it amphiphilic. It is often used in biochemical applications, particularly in the study of membrane interactions and as a potential surfactant due to its ability to interact with lipid bilayers. The presence of the nitro group contributes to its potential as a chromophore, allowing for UV-visible spectroscopic applications. Additionally, the long hydrocarbon chain enhances its lipophilicity, which can influence its solubility in organic solvents and its behavior in biological systems. Safety data should be consulted for handling, as compounds with nitro groups can sometimes be hazardous. Overall, this compound serves as a useful tool in various chemical and biological research fields.
Formula:C22H36N2O4
InChI:InChI=1/C22H36N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22(26)23-20-18-19(24(27)28)16-17-21(20)25/h16-18,25H,2-15H2,1H3,(H,23,26)
SMILES:CCCCCCCCCCCCCCCC(=Nc1cc(ccc1O)N(=O)=O)O
Synonyms:- N-(2-hydroxy-5-nitrophenyl)hexadecanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2’-Hydroxy-5’-nitrohexadecanamide
CAS:Controlled ProductApplications Used in the synthesis of a chromogenic substrate for assaying sphingomyelinase activity.
References Gal, A.E., et al.: Chem. Physics Lipids, 16, 71 (1976), Levade, T., et al.: Anal. Biochem., 130, 521 (1983),Formula:C22H36N2O4Color and Shape:NeatMolecular weight:392.532'-Hydroxy-5'-nitrohexadecanamide
CAS:2'-Hydroxy-5'-nitrohexadecanamide is a synthetic fatty acid derivative that inhibits lysosomal hydrolase, which is an enzyme that breaks down cellular lipids. This compound can be used as a diagnostic agent for the detection of certain types of cancer. 2'-Hydroxy-5'-nitrohexadecanamide reacts with the magnesium ion in the lysosome to form an insoluble precipitate, which then settles to the bottom of the test tube, allowing for easy detection of cells with high levels of lysosomal hydrolase.Formula:C22H36N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:392.53 g/mol



