CymitQuimica logo

CAS 603069-11-0

:

2-(2,5-Difluorophenyl)-4-methylpyrrolidine

Description:
2-(2,5-Difluorophenyl)-4-methylpyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a 2,5-difluorophenyl group and a methyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the fluorinated phenyl ring and the saturated pyrrolidine structure. The difluorophenyl moiety can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. Additionally, the presence of fluorine atoms often imparts unique characteristics such as increased lipophilicity and altered biological activity. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be analyzed using methods such as NMR, mass spectrometry, and chromatography to confirm its structure and purity.
Formula:C11H13F2N
InChI:InChI=1S/C11H13F2N/c1-7-4-11(14-6-7)9-5-8(12)2-3-10(9)13/h2-3,5,7,11,14H,4,6H2,1H3
InChI key:InChIKey=BSJLJRRBCVRSIV-UHFFFAOYSA-N
SMILES:FC1=C(C=C(F)C=C1)C2CC(C)CN2
Synonyms:
  • Pyrrolidine, 2-(2,5-difluorophenyl)-4-methyl-
  • 2-(2,5-Difluorophenyl)-4-methylpyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.