CAS 603118-21-4

3-[(2-Methyl-1-piperidinyl)sulfonyl]benzoic acid

Description:

3-[(2-Methyl-1-piperidinyl)sulfonyl]benzoic acid, identified by its CAS number 603118-21-4, is a chemical compound characterized by its sulfonamide functional group attached to a benzoic acid moiety. This compound features a piperidine ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the sulfonyl group enhances its solubility and reactivity, making it a candidate for various applications, including pharmaceuticals. The molecular structure typically exhibits a carboxylic acid group, which can participate in hydrogen bonding, influencing its interactions in biological systems. Additionally, the methyl substitution on the piperidine ring can affect the compound's lipophilicity and overall pharmacokinetic properties. Overall, this compound's unique structural features suggest potential utility in drug development, particularly in targeting specific biological pathways or receptors. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its applications.

Formula: C₁₃H₁₇NO₄S

InChI: InChI=1S/C13H17NO4S/c1-10-5-2-3-8-14(10)19(17,18)12-7-4-6-11(9-12)13(15)16/h4,6-7,9-10H,2-3,5,8H2,1H3,(H,15,16)

InChI key: InChIKey=MJQIFIAOLXFCLO-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C(C)CCCC1)C2=CC(C(O)=O)=CC=C2

Synonyms:

• 3-[(2-Methyl-1-piperidinyl)sulfonyl]benzoic acid
• Benzoic acid, 3-[(2-methyl-1-piperidinyl)sulfonyl]-

3-[(2-Methylpiperidin-1-yl)sulfonyl]benzoic acid

CAS: 603118-21-4

Versatile small molecule scaffold

Formula: C₁₃H₁₇NO₄S

Purity: Min. 95%

Molecular weight: 283.35 g/mol

Ref: 3D-DZA11821