CAS 603122-41-4

[3-methoxy-4-(methoxycarbonyl)phenyl]boronic acid

Description:

[3-Methoxy-4-(methoxycarbonyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with both a methoxy group and a methoxycarbonyl group, enhancing its solubility and reactivity. The methoxy group contributes to the electron-donating properties, while the methoxycarbonyl group introduces a carbonyl functionality that can participate in various chemical reactions, such as esterification or acylation. The boronic acid moiety allows for applications in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Additionally, this compound may exhibit interesting biological activities, as boronic acids are often explored for their potential in medicinal chemistry. Its stability, solubility in organic solvents, and reactivity with nucleophiles make it a versatile building block in the synthesis of complex organic molecules.

Formula: C₉H₁₁BO₅

InChI: InChI=1/C9H11BO5/c1-14-8-5-6(10(12)13)3-4-7(8)9(11)15-2/h3-5,12-13H,1-2H3

SMILES: COc1cc(ccc1C(=O)OC)B(O)O

Synonyms:

• Benzoic Acid, 4-Borono-2-Methoxy-, Methyl Ester
• 3-Methoxy-4-methoxycarbonylphenylboronic acid

3-Methoxy-4-Methoxycarbonylphenylboronic Acid

CAS: 603122-41-4

Formula: C₉H₁₁BO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 209.9916

Ref: IN-DA00EA07

3-Methoxy-4-(methoxycarbonyl)benzeneboronic acid

CAS: 603122-41-4

3-Methoxy-4-(methoxycarbonyl)benzeneboronic acid

Formula: C₉H₁₁BO₅

Purity: ≥95%

Color and Shape: beige solid

Molecular weight: 209.99g/mol

Ref: 54-OR5799

3-Methoxy-4-methoxycarbonylphenylboronic acid

CAS: 603122-41-4

Formula: C₉H₁₁BO₅

Purity: 95%

Color and Shape: Solid, Powder

Molecular weight: 209.99

Ref: 10-F219495