CymitQuimica logo

CAS 603137-41-3

:

4-[[3-(2-dimethylaminoethyl)-1H-indol-5-yl]methylsulfonylamino]butanoic acid

Description:
4-[[3-(2-Dimethylaminoethyl)-1H-indol-5-yl]methylsulfonylamino]butanoic acid, identified by its CAS number 603137-41-3, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety, a sulfonamide group, and a butanoic acid chain. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of polar functional groups, such as the sulfonamide and carboxylic acid, alongside the hydrophobic indole ring. It may display biological activity, potentially acting as a pharmacological agent, although specific biological properties would depend on its interactions at the molecular level. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its synthesis and handling require careful consideration of safety protocols due to the presence of amine groups, which can be reactive. Overall, this compound represents a class of molecules that may have applications in medicinal chemistry and drug development.
Formula:C17H25N3O4S
InChI:InChI=1/C17H25N3O4S/c1-20(2)9-7-14-11-18-16-6-5-13(10-15(14)16)12-25(23,24)19-8-3-4-17(21)22/h5-6,10-11,18-19H,3-4,7-9,12H2,1-2H3,(H,21,22)
SMILES:CN(C)CCc1c[nH]c2ccc(cc12)CS(=O)(=O)NCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.