CAS 60318-63-0
:(3R,4R,5R,6R)-6-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-propanoyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:
The chemical substance with the name "(3R,4R,5R,6R)-6-[2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-propanoyl]oxy-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid" and CAS number "60318-63-0" is a complex organic compound characterized by its tetrahydropyran structure, which features multiple hydroxyl groups contributing to its hydrophilicity. The presence of a carboxylic acid group indicates acidic properties, while the chlorobenzoyl and phenoxy substituents suggest potential for significant biological activity, possibly influencing interactions with biological targets. The stereochemistry denoted by the (3R,4R,5R,6R) configuration indicates specific spatial arrangements of the hydroxyl groups, which can affect the compound's reactivity and interactions. This compound may exhibit properties such as solubility in polar solvents and potential applications in pharmaceuticals or biochemistry, particularly in the context of drug design or as a biochemical probe. Its structural complexity and functional groups suggest it could participate in various chemical reactions, making it of interest for further study in medicinal chemistry and related fields.
Formula:C23H23ClO10
InChI:InChI=1/C23H23ClO10/c1-23(2,22(31)33-21-18(28)16(26)17(27)19(32-21)20(29)30)34-14-9-5-12(6-10-14)15(25)11-3-7-13(24)8-4-11/h3-10,16-19,21,26-28H,1-2H3,(H,29,30)/t16-,17-,18-,19?,21-/m1/s1
SMILES:CC(C)(C(=O)O[C@@H]1[C@@H]([C@@H]([C@H](C(C(=O)O)O1)O)O)O)Oc1ccc(cc1)C(=O)c1ccc(cc1)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Fenofibric acid-acyl-β-D-glucuronide
CAS:Fenofibric acid-acyl-β-D-glucuronidePurity:>98%Molecular weight:494.88g/molFenofibric Acid Acyl-beta-D-glucuronide (~90%)
CAS:Stability Hygroscopic
Applications A metabolite of Fenofibrate (F248640).
References Heberer, T., et al.: Toxicol. Lett., 131 5 (2002), Larsen, T., et al.: J. Biotechnol., 113, 295 (2004), Escher, B., et al.: Environ. Sci. Technol., 40, 7402 (2006),Formula:C23H23ClO10Purity:~90%Color and Shape:NeatMolecular weight:494.88Fenofibryl b-D-glucuronide
CAS:Fenofibryl b-D-glucuronide is a potential anticancer drug that has been shown to inhibit growth and induce apoptosis in human liver cancer cells. Fenofibryl b-D-glucuronide is also known to have the ability to react with covalent adducts, which may be due to its reactive nature. It is not currently known how this compound interacts with other drugs or how it affects body mass index in humans.Formula:C23H23ClO10Purity:Min. 95%Molecular weight:494.88 g/mol




